C44H58Cl2FN3O3 — CID 70206293
N-[7-[1-(5-aminopentyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide;dihydrochloride (PubChem CID 70206293) has the molecular formula C44H58Cl2FN3O3 and a molecular weight of 766.87 g/mol. Its IUPAC name is N-[7-[1-(5-aminopentyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide;dihydrochloride.
| Compound Name | N-[7-[1-(5-aminopentyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide;dihydrochloride |
|---|---|
| PubChem CID | 70206293 |
| Molecular Formula | C44H58Cl2FN3O3 |
| Molecular Weight | 766.87 g/mol |
| Exact Mass | 765.38 |
| IUPAC Name | N-[7-[1-(5-aminopentyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide;dihydrochloride |
| SMILES | COc1cc2c(cc1OC)C(CCCCCN)N(CCCC(CCCNC(=O)CCc1ccc(F)cc1)(c1ccccc1)c1ccccc1)CC2.Cl.Cl |
| InChI | InChI=1S/C44H56FN3O3.2ClH/c1-50-41-32-35-25-31-48(40(18-10-5-11-28-46)39(35)33-42(41)51-2)30-13-27-44(36-14-6-3-7-15-36,37-16-8-4-9-17-37)26-12-29-47-43(49)24-21-34-19-22-38(45)23-20-34;;/h3-4,6-9,14-17,19-20,22-23,32-33,40H,5,10-13,18,21,24-31,46H2,1-2H3,(H,47,49);2*1H |
| InChIKey | BDJOTCRQDRVQIO-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.87 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|