C45H57ClN2O5 — CID 19045664
2-(3,4-dimethoxyphenyl)-N-[7-(6,7-dimethoxyspiro[2,4-dihydro-1H-naphthalene-3,2'-piperidine]-1'-yl)-4,4-diphenylheptyl]acetamide;hydrochloride (PubChem CID 19045664) has the molecular formula C45H57ClN2O5 and a molecular weight of 741.41 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[7-(6,7-dimethoxyspiro[2,4-dihydro-1H-naphthalene-3,2'-piperidine]-1'-yl)-4,4-diphenylheptyl]acetamide;hydrochloride.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[7-(6,7-dimethoxyspiro[2,4-dihydro-1H-naphthalene-3,2'-piperidine]-1'-yl)-4,4-diphenylheptyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 19045664 |
| Molecular Formula | C45H57ClN2O5 |
| Molecular Weight | 741.41 g/mol |
| Exact Mass | 740.40 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[7-(6,7-dimethoxyspiro[2,4-dihydro-1H-naphthalene-3,2'-piperidine]-1'-yl)-4,4-diphenylheptyl]acetamide;hydrochloride |
| SMILES | COc1ccc(CC(=O)NCCCC(CCCN2CCCCC23CCc2cc(OC)c(OC)cc2C3)(c2ccccc2)c2ccccc2)cc1OC.Cl |
| InChI | InChI=1S/C45H56N2O5.ClH/c1-49-39-20-19-34(29-40(39)50-2)30-43(48)46-26-13-23-45(37-15-7-5-8-16-37,38-17-9-6-10-18-38)24-14-28-47-27-12-11-22-44(47)25-21-35-31-41(51-3)42(52-4)32-36(35)33-44;/h5-10,15-20,29,31-32H,11-14,21-28,30,33H2,1-4H3,(H,46,48);1H |
| InChIKey | MBZFECLRQPNULW-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.41 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|