C42H52FN3O3 — CID 57153493
N-[7-[1-(3-aminopropyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide (PubChem CID 57153493) has the molecular formula C42H52FN3O3 and a molecular weight of 665.89 g/mol. Its IUPAC name is N-[7-[1-(3-aminopropyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide.
| Compound Name | N-[7-[1-(3-aminopropyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 57153493 |
| Molecular Formula | C42H52FN3O3 |
| Molecular Weight | 665.89 g/mol |
| Exact Mass | 665.40 |
| IUPAC Name | N-[7-[1-(3-aminopropyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide |
| SMILES | COc1cc2c(cc1OC)C(CCCN)N(CCCC(CCCNC(=O)CCc1ccc(F)cc1)(c1ccccc1)c1ccccc1)CC2 |
| InChI | InChI=1S/C42H52FN3O3/c1-48-39-30-33-23-29-46(38(16-9-26-44)37(33)31-40(39)49-2)28-11-25-42(34-12-5-3-6-13-34,35-14-7-4-8-15-35)24-10-27-45-41(47)22-19-32-17-20-36(43)21-18-32/h3-8,12-15,17-18,20-21,30-31,38H,9-11,16,19,22-29,44H2,1-2H3,(H,45,47) |
| InChIKey | BJCCMVKBRXTENT-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.89 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|