C45H58FN3O3 — CID 70208714
N-[7-[1-[4-(dimethylamino)butyl]-6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-yl]-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide (PubChem CID 70208714) has the molecular formula C45H58FN3O3 and a molecular weight of 707.98 g/mol. Its IUPAC name is N-[7-[1-[4-(dimethylamino)butyl]-6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-yl]-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide.
| Compound Name | N-[7-[1-[4-(dimethylamino)butyl]-6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-yl]-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 70208714 |
| Molecular Formula | C45H58FN3O3 |
| Molecular Weight | 707.98 g/mol |
| Exact Mass | 707.45 |
| IUPAC Name | N-[7-[1-[4-(dimethylamino)butyl]-6,7-dimethoxy-3,4-dihydro-2H-isoquinolin-1-yl]-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide |
| SMILES | COc1cc2c(cc1OC)C(CCCCN(C)C)(CCCC(CCCNC(=O)CCc1ccc(F)cc1)(c1ccccc1)c1ccccc1)NCC2 |
| InChI | InChI=1S/C45H58FN3O3/c1-49(2)32-12-11-28-45(40-34-42(52-4)41(51-3)33-36(40)25-31-48-45)29-13-26-44(37-15-7-5-8-16-37,38-17-9-6-10-18-38)27-14-30-47-43(50)24-21-35-19-22-39(46)23-20-35/h5-10,15-20,22-23,33-34,48H,11-14,21,24-32H2,1-4H3,(H,47,50) |
| InChIKey | WBNBBIFNHHLCED-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.98 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|