C40H48ClFN2O3 — CID 70204819
N-[7-(6,7-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide;hydrochloride (PubChem CID 70204819) has the molecular formula C40H48ClFN2O3 and a molecular weight of 659.29 g/mol. Its IUPAC name is N-[7-(6,7-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide;hydrochloride.
| Compound Name | N-[7-(6,7-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 70204819 |
| Molecular Formula | C40H48ClFN2O3 |
| Molecular Weight | 659.29 g/mol |
| Exact Mass | 658.33 |
| IUPAC Name | N-[7-(6,7-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide;hydrochloride |
| SMILES | COc1cc2c(cc1OC)C(C)N(CCCC(CCCNC(=O)CCc1ccc(F)cc1)(c1ccccc1)c1ccccc1)CC2.Cl |
| InChI | InChI=1S/C40H47FN2O3.ClH/c1-30-36-29-38(46-3)37(45-2)28-32(36)22-27-43(30)26-11-24-40(33-12-6-4-7-13-33,34-14-8-5-9-15-34)23-10-25-42-39(44)21-18-31-16-19-35(41)20-17-31;/h4-9,12-17,19-20,28-30H,10-11,18,21-27H2,1-3H3,(H,42,44);1H |
| InChIKey | IQYVNKMWUWDBQW-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.29 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|