C46H54Cl2FN3O3 — CID 70209042
N-[7-[3-[1-(aminomethyl)cyclohex-2-en-1-yl]-6,7-dimethoxyisoquinolin-1-yl]-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide;dihydrochloride (PubChem CID 70209042) has the molecular formula C46H54Cl2FN3O3 and a molecular weight of 786.86 g/mol. Its IUPAC name is N-[7-[3-[1-(aminomethyl)cyclohex-2-en-1-yl]-6,7-dimethoxyisoquinolin-1-yl]-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide;dihydrochloride.
| Compound Name | N-[7-[3-[1-(aminomethyl)cyclohex-2-en-1-yl]-6,7-dimethoxyisoquinolin-1-yl]-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide;dihydrochloride |
|---|---|
| PubChem CID | 70209042 |
| Molecular Formula | C46H54Cl2FN3O3 |
| Molecular Weight | 786.86 g/mol |
| Exact Mass | 785.35 |
| IUPAC Name | N-[7-[3-[1-(aminomethyl)cyclohex-2-en-1-yl]-6,7-dimethoxyisoquinolin-1-yl]-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide;dihydrochloride |
| SMILES | COc1cc2cc(C3(CN)C=CCCC3)nc(CCCC(CCCNC(=O)CCc3ccc(F)cc3)(c3ccccc3)c3ccccc3)c2cc1OC.Cl.Cl |
| InChI | InChI=1S/C46H52FN3O3.2ClH/c1-52-41-30-35-31-43(45(33-48)25-10-5-11-26-45)50-40(39(35)32-42(41)53-2)18-12-27-46(36-14-6-3-7-15-36,37-16-8-4-9-17-37)28-13-29-49-44(51)24-21-34-19-22-38(47)23-20-34;;/h3-4,6-10,14-17,19-20,22-23,25,30-32H,5,11-13,18,21,24,26-29,33,48H2,1-2H3,(H,49,51);2*1H |
| InChIKey | RZBSVFXBHAARKB-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.86 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|