C46H52ClFN2O4 — CID 70206255
N-[7-[6,7-dimethoxy-3-(1-methoxycyclohex-2-en-1-yl)isoquinolin-1-yl]-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide;hydrochloride (PubChem CID 70206255) has the molecular formula C46H52ClFN2O4 and a molecular weight of 751.38 g/mol. Its IUPAC name is N-[7-[6,7-dimethoxy-3-(1-methoxycyclohex-2-en-1-yl)isoquinolin-1-yl]-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide;hydrochloride.
| Compound Name | N-[7-[6,7-dimethoxy-3-(1-methoxycyclohex-2-en-1-yl)isoquinolin-1-yl]-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 70206255 |
| Molecular Formula | C46H52ClFN2O4 |
| Molecular Weight | 751.38 g/mol |
| Exact Mass | 750.36 |
| IUPAC Name | N-[7-[6,7-dimethoxy-3-(1-methoxycyclohex-2-en-1-yl)isoquinolin-1-yl]-4,4-diphenylheptyl]-3-(4-fluorophenyl)propanamide;hydrochloride |
| SMILES | COc1cc2cc(C3(OC)C=CCCC3)nc(CCCC(CCCNC(=O)CCc3ccc(F)cc3)(c3ccccc3)c3ccccc3)c2cc1OC.Cl |
| InChI | InChI=1S/C46H51FN2O4.ClH/c1-51-41-31-35-32-43(46(53-3)28-11-6-12-29-46)49-40(39(35)33-42(41)52-2)19-13-26-45(36-15-7-4-8-16-36,37-17-9-5-10-18-37)27-14-30-48-44(50)25-22-34-20-23-38(47)24-21-34;/h4-5,7-11,15-18,20-21,23-24,28,31-33H,6,12-14,19,22,25-27,29-30H2,1-3H3,(H,48,50);1H |
| InChIKey | TWEGPYBHPNYIIV-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.38 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|