C24H27NO4 — CID 57282268
2-ethyl-6-methoxy-9-(3-phenylpropoxy)-4,5-dihydrobenzo[e]isoindole-1,3-diol (PubChem CID 57282268) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is 2-ethyl-6-methoxy-9-(3-phenylpropoxy)-4,5-dihydrobenzo[e]isoindole-1,3-diol.
| Compound Name | 2-ethyl-6-methoxy-9-(3-phenylpropoxy)-4,5-dihydrobenzo[e]isoindole-1,3-diol |
|---|---|
| PubChem CID | 57282268 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 2-ethyl-6-methoxy-9-(3-phenylpropoxy)-4,5-dihydrobenzo[e]isoindole-1,3-diol |
| SMILES | CCn1c(O)c2c(c1O)-c1c(OCCCc3ccccc3)ccc(OC)c1CC2 |
| InChI | InChI=1S/C24H27NO4/c1-3-25-23(26)18-12-11-17-19(28-2)13-14-20(21(17)22(18)24(25)27)29-15-7-10-16-8-5-4-6-9-16/h4-6,8-9,13-14,26-27H,3,7,10-12,15H2,1-2H3 |
| InChIKey | VNNVCKSMUNWKJA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 63.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|