C20H31N5O3S — CID 57292206
N-(diaminomethylidene)-3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-piperidin-1-ylbenzamide (PubChem CID 57292206) has the molecular formula C20H31N5O3S and a molecular weight of 421.57 g/mol. Its IUPAC name is N-(diaminomethylidene)-3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-piperidin-1-ylbenzamide.
| Compound Name | N-(diaminomethylidene)-3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 57292206 |
| Molecular Formula | C20H31N5O3S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | N-(diaminomethylidene)-3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-piperidin-1-ylbenzamide |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2cc(C(=O)N=C(N)N)ccc2N2CCCCC2)C1 |
| InChI | InChI=1S/C20H31N5O3S/c1-14-10-15(2)13-25(12-14)29(27,28)18-11-16(19(26)23-20(21)22)6-7-17(18)24-8-4-3-5-9-24/h6-7,11,14-15H,3-5,8-10,12-13H2,1-2H3,(H4,21,22,23,26) |
| InChIKey | FTYOFJOALLQGSR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|