C21H35ClO7 — CID 57303839
methyl 4-chloro-4-[5-(dimethoxymethyl)-6-(oxan-2-yloxy)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-yl]butanoate (PubChem CID 57303839) has the molecular formula C21H35ClO7 and a molecular weight of 434.96 g/mol. Its IUPAC name is methyl 4-chloro-4-[5-(dimethoxymethyl)-6-(oxan-2-yloxy)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-yl]butanoate.
| Compound Name | methyl 4-chloro-4-[5-(dimethoxymethyl)-6-(oxan-2-yloxy)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-yl]butanoate |
|---|---|
| PubChem CID | 57303839 |
| Molecular Formula | C21H35ClO7 |
| Molecular Weight | 434.96 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | methyl 4-chloro-4-[5-(dimethoxymethyl)-6-(oxan-2-yloxy)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-yl]butanoate |
| SMILES | COC(=O)CCC(Cl)C1CC2CC(C(OC)OC)C(OC3CCCCO3)CC2O1 |
| InChI | InChI=1S/C21H35ClO7/c1-24-19(23)8-7-15(22)18-11-13-10-14(21(25-2)26-3)17(12-16(13)28-18)29-20-6-4-5-9-27-20/h13-18,20-21H,4-12H2,1-3H3 |
| InChIKey | XYSGKBZLGYVXTR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.96 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|