C19H29NO2 — CID 57317191
1-[5-[4-(diethylaminomethyl)phenyl]-2-hydroxycyclohexyl]ethanone (PubChem CID 57317191) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is 1-[5-[4-(diethylaminomethyl)phenyl]-2-hydroxycyclohexyl]ethanone.
| Compound Name | 1-[5-[4-(diethylaminomethyl)phenyl]-2-hydroxycyclohexyl]ethanone |
|---|---|
| PubChem CID | 57317191 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | 1-[5-[4-(diethylaminomethyl)phenyl]-2-hydroxycyclohexyl]ethanone |
| SMILES | CCN(CC)Cc1ccc(C2CCC(O)C(C(C)=O)C2)cc1 |
| InChI | InChI=1S/C19H29NO2/c1-4-20(5-2)13-15-6-8-16(9-7-15)17-10-11-19(22)18(12-17)14(3)21/h6-9,17-19,22H,4-5,10-13H2,1-3H3 |
| InChIKey | YDOWHSXBXKVQDN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |