C21H23NO10Se — CID 57327766
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-oxo-1,2-benzoselenazol-2-yl)oxan-2-yl]methyl acetate (PubChem CID 57327766) has the molecular formula C21H23NO10Se and a molecular weight of 528.37 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-oxo-1,2-benzoselenazol-2-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-oxo-1,2-benzoselenazol-2-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 57327766 |
| Molecular Formula | C21H23NO10Se |
| Molecular Weight | 528.37 g/mol |
| Exact Mass | 529.05 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(3-oxo-1,2-benzoselenazol-2-yl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2[se]c3ccccc3c2=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H23NO10Se/c1-10(23)28-9-15-17(29-11(2)24)18(30-12(3)25)19(31-13(4)26)21(32-15)22-20(27)14-7-5-6-8-16(14)33-22/h5-8,15,17-19,21H,9H2,1-4H3/t15-,17-,18+,19-,21-/m1/s1 |
| InChIKey | IJXCDBAYWUTTKO-PEVLUNPASA-N |
| XLogP | 0.31 |
| TPSA | 136.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.37 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|