C25H30N2O11Se — CID 57327842
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-(3-oxo-1,2-benzoselenazol-2-yl)butanoylamino]oxan-2-yl]methyl acetate (PubChem CID 57327842) has the molecular formula C25H30N2O11Se and a molecular weight of 613.48 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-(3-oxo-1,2-benzoselenazol-2-yl)butanoylamino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-(3-oxo-1,2-benzoselenazol-2-yl)butanoylamino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 57327842 |
| Molecular Formula | C25H30N2O11Se |
| Molecular Weight | 613.48 g/mol |
| Exact Mass | 614.10 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-(3-oxo-1,2-benzoselenazol-2-yl)butanoylamino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](NC(=O)CCCn2[se]c3ccccc3c2=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H30N2O11Se/c1-13(28)34-12-18-21(35-14(2)29)22(36-15(3)30)23(37-16(4)31)24(38-18)26-20(32)10-7-11-27-25(33)17-8-5-6-9-19(17)39-27/h5-6,8-9,18,21-24H,7,10-12H2,1-4H3,(H,26,32)/t18-,21-,22+,23-,24-/m1/s1 |
| InChIKey | YZUQFAROCPSMBL-REXJZNOJSA-N |
| XLogP | 0.04 |
| TPSA | 165.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.48 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|