C17H15NO2S — CID 57328496
(1R,13S)-5,7-dioxa-11-thia-14-azapentacyclo[11.8.0.02,10.04,8.016,21]henicosa-2,4(8),9,16,18,20-hexaene (PubChem CID 57328496) has the molecular formula C17H15NO2S and a molecular weight of 297.38 g/mol. Its IUPAC name is (1R,13S)-5,7-dioxa-11-thia-14-azapentacyclo[11.8.0.02,10.04,8.016,21]henicosa-2,4(8),9,16,18,20-hexaene.
| Compound Name | (1R,13S)-5,7-dioxa-11-thia-14-azapentacyclo[11.8.0.02,10.04,8.016,21]henicosa-2,4(8),9,16,18,20-hexaene |
|---|---|
| PubChem CID | 57328496 |
| Molecular Formula | C17H15NO2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | (1R,13S)-5,7-dioxa-11-thia-14-azapentacyclo[11.8.0.02,10.04,8.016,21]henicosa-2,4(8),9,16,18,20-hexaene |
| SMILES | c1ccc2c(c1)CN[C@@H]1CSc3cc4c(cc3[C@@H]21)OCO4 |
| InChI | InChI=1S/C17H15NO2S/c1-2-4-11-10(3-1)7-18-13-8-21-16-6-15-14(19-9-20-15)5-12(16)17(11)13/h1-6,13,17-18H,7-9H2/t13-,17-/m1/s1 |
| InChIKey | VYRYHDQEFPEXTE-CXAGYDPISA-N |
| XLogP | 3.12 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |