C21H20O3 — CID 57337957
[(1S)-2,3-dihydro-1H-inden-1-yl] (2S)-2-methoxy-2-phenylpent-3-ynoate (PubChem CID 57337957) has the molecular formula C21H20O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is [(1S)-2,3-dihydro-1H-inden-1-yl] (2S)-2-methoxy-2-phenylpent-3-ynoate.
| Compound Name | [(1S)-2,3-dihydro-1H-inden-1-yl] (2S)-2-methoxy-2-phenylpent-3-ynoate |
|---|---|
| PubChem CID | 57337957 |
| Molecular Formula | C21H20O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | [(1S)-2,3-dihydro-1H-inden-1-yl] (2S)-2-methoxy-2-phenylpent-3-ynoate |
| SMILES | CC#C[C@](OC)(C(=O)O[C@H]1CCc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C21H20O3/c1-3-15-21(23-2,17-10-5-4-6-11-17)20(22)24-19-14-13-16-9-7-8-12-18(16)19/h4-12,19H,13-14H2,1-2H3/t19-,21+/m0/s1 |
| InChIKey | LRFYAYGZHPBNAL-PZJWPPBQSA-N |
| XLogP | 3.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|