C19H20O7 — CID 57343418
1-(3-hydroxypropoxy)-7,9-dimethoxy-3-methyl-1H-benzo[g]isochromene-5,10-dione (PubChem CID 57343418) has the molecular formula C19H20O7 and a molecular weight of 360.36 g/mol. Its IUPAC name is 1-(3-hydroxypropoxy)-7,9-dimethoxy-3-methyl-1H-benzo[g]isochromene-5,10-dione.
| Compound Name | 1-(3-hydroxypropoxy)-7,9-dimethoxy-3-methyl-1H-benzo[g]isochromene-5,10-dione |
|---|---|
| PubChem CID | 57343418 |
| Molecular Formula | C19H20O7 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 1-(3-hydroxypropoxy)-7,9-dimethoxy-3-methyl-1H-benzo[g]isochromene-5,10-dione |
| SMILES | COc1cc(OC)c2c(c1)C(=O)C1=C(C2=O)C(OCCCO)OC(C)=C1 |
| InChI | InChI=1S/C19H20O7/c1-10-7-12-16(19(26-10)25-6-4-5-20)18(22)15-13(17(12)21)8-11(23-2)9-14(15)24-3/h7-9,19-20H,4-6H2,1-3H3 |
| InChIKey | WKWMFNAZBDRXMH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|