C18H9BrO3 — CID 57343643
2-bromo-11-hydroxybenzo[a]anthracene-7,12-dione (PubChem CID 57343643) has the molecular formula C18H9BrO3 and a molecular weight of 353.17 g/mol. Its IUPAC name is 2-bromo-11-hydroxybenzo[a]anthracene-7,12-dione.
| Compound Name | 2-bromo-11-hydroxybenzo[a]anthracene-7,12-dione |
|---|---|
| PubChem CID | 57343643 |
| Molecular Formula | C18H9BrO3 |
| Molecular Weight | 353.17 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | 2-bromo-11-hydroxybenzo[a]anthracene-7,12-dione |
| SMILES | O=C1c2cccc(O)c2C(=O)c2c1ccc1ccc(Br)cc21 |
| InChI | InChI=1S/C18H9BrO3/c19-10-6-4-9-5-7-12-15(13(9)8-10)18(22)16-11(17(12)21)2-1-3-14(16)20/h1-8,20H |
| InChIKey | DFMIUWWRHPYUBL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.17 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|