C23H27N5O2 — CID 57356570
(1,2-dimethylindol-3-yl)-(1,5-dimethyl-2-phenyl-1,3-dihydropyrazol-1-ium-3-yl)diazene acetate (PubChem CID 57356570) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is (1,2-dimethylindol-3-yl)-(1,5-dimethyl-2-phenyl-1,3-dihydropyrazol-1-ium-3-yl)diazene acetate.
| Compound Name | (1,2-dimethylindol-3-yl)-(1,5-dimethyl-2-phenyl-1,3-dihydropyrazol-1-ium-3-yl)diazene acetate |
|---|---|
| PubChem CID | 57356570 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | (1,2-dimethylindol-3-yl)-(1,5-dimethyl-2-phenyl-1,3-dihydropyrazol-1-ium-3-yl)diazene acetate |
| SMILES | CC(=O)[O-].CC1=CC(/N=N/c2c(C)n(C)c3ccccc23)N(c2ccccc2)[NH+]1C |
| InChI | InChI=1S/C21H23N5.C2H4O2/c1-15-14-20(26(25(15)4)17-10-6-5-7-11-17)22-23-21-16(2)24(3)19-13-9-8-12-18(19)21;1-2(3)4/h5-14,20H,1-4H3;1H3,(H,3,4)/b23-22+; |
| InChIKey | RROUEJPHWJNURR-PGCQSHBKSA-N |
| XLogP | 2.51 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|