C23H13ClN2O2 — CID 57384746
4-(4-chlorophenyl)-8-methyl-2-oxo-11H-pyrano[2,3-a]carbazole-3-carbonitrile (PubChem CID 57384746) has the molecular formula C23H13ClN2O2 and a molecular weight of 384.82 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-8-methyl-2-oxo-11H-pyrano[2,3-a]carbazole-3-carbonitrile.
| Compound Name | 4-(4-chlorophenyl)-8-methyl-2-oxo-11H-pyrano[2,3-a]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 57384746 |
| Molecular Formula | C23H13ClN2O2 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 4-(4-chlorophenyl)-8-methyl-2-oxo-11H-pyrano[2,3-a]carbazole-3-carbonitrile |
| SMILES | Cc1ccc2[nH]c3c(ccc4c(-c5ccc(Cl)cc5)c(C#N)c(=O)oc43)c2c1 |
| InChI | InChI=1S/C23H13ClN2O2/c1-12-2-9-19-17(10-12)15-7-8-16-20(13-3-5-14(24)6-4-13)18(11-25)23(27)28-22(16)21(15)26-19/h2-10,26H,1H3 |
| InChIKey | MWJJGQXWKGTBQT-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|