C25H29NO3S — CID 57414152
N-[2-(1H-isochromen-4-ylidenemethylidene)cyclooctyl]-4-methylbenzenesulfonamide (PubChem CID 57414152) has the molecular formula C25H29NO3S and a molecular weight of 423.58 g/mol. Its IUPAC name is N-[2-(1H-isochromen-4-ylidenemethylidene)cyclooctyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-(1H-isochromen-4-ylidenemethylidene)cyclooctyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 57414152 |
| Molecular Formula | C25H29NO3S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | N-[2-(1H-isochromen-4-ylidenemethylidene)cyclooctyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC2CCCCCCC2=C=C2COCc3ccccc32)cc1 |
| InChI | InChI=1S/C25H29NO3S/c1-19-12-14-23(15-13-19)30(27,28)26-25-11-5-3-2-4-8-20(25)16-22-18-29-17-21-9-6-7-10-24(21)22/h6-7,9-10,12-15,25-26H,2-5,8,11,17-18H2,1H3 |
| InChIKey | ROLKDOSLNKWFJS-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |