C28H33ClFN6O7P — CID 57447206
[3-[3-[4-[[2-[(3-chloro-4-fluorophenyl)methoxy]pyrimidin-5-yl]amino]-6-methoxyquinazolin-7-yl]oxypropylamino]-3-methylbutyl] dihydrogen phosphate (PubChem CID 57447206) has the molecular formula C28H33ClFN6O7P and a molecular weight of 651.03 g/mol. Its IUPAC name is [3-[3-[4-[[2-[(3-chloro-4-fluorophenyl)methoxy]pyrimidin-5-yl]amino]-6-methoxyquinazolin-7-yl]oxypropylamino]-3-methylbutyl] dihydrogen phosphate.
| Compound Name | [3-[3-[4-[[2-[(3-chloro-4-fluorophenyl)methoxy]pyrimidin-5-yl]amino]-6-methoxyquinazolin-7-yl]oxypropylamino]-3-methylbutyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 57447206 |
| Molecular Formula | C28H33ClFN6O7P |
| Molecular Weight | 651.03 g/mol |
| Exact Mass | 650.18 |
| IUPAC Name | [3-[3-[4-[[2-[(3-chloro-4-fluorophenyl)methoxy]pyrimidin-5-yl]amino]-6-methoxyquinazolin-7-yl]oxypropylamino]-3-methylbutyl] dihydrogen phosphate |
| SMILES | COc1cc2c(Nc3cnc(OCc4ccc(F)c(Cl)c4)nc3)ncnc2cc1OCCCNC(C)(C)CCOP(=O)(O)O |
| InChI | InChI=1S/C28H33ClFN6O7P/c1-28(2,7-10-43-44(37,38)39)35-8-4-9-41-25-13-23-20(12-24(25)40-3)26(34-17-33-23)36-19-14-31-27(32-15-19)42-16-18-5-6-22(30)21(29)11-18/h5-6,11-15,17,35H,4,7-10,16H2,1-3H3,(H,33,34,36)(H2,37,38,39) |
| InChIKey | PSEZLVPBIGEAKF-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 170.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.03 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|