C40H36S2 — CID 58106576
3,5-bis(4-butylphenyl)-12,14-dimethyl-4,13-dithiahexacyclo[8.8.2.02,6.07,19.011,15.016,20]icosa-1(19),2,5,7,9,11,14,16(20),17-nonaene (PubChem CID 58106576) has the molecular formula C40H36S2 and a molecular weight of 580.86 g/mol. Its IUPAC name is 3,5-bis(4-butylphenyl)-12,14-dimethyl-4,13-dithiahexacyclo[8.8.2.02,6.07,19.011,15.016,20]icosa-1(19),2,5,7,9,11,14,16(20),17-nonaene.
| Compound Name | 3,5-bis(4-butylphenyl)-12,14-dimethyl-4,13-dithiahexacyclo[8.8.2.02,6.07,19.011,15.016,20]icosa-1(19),2,5,7,9,11,14,16(20),17-nonaene |
|---|---|
| PubChem CID | 58106576 |
| Molecular Formula | C40H36S2 |
| Molecular Weight | 580.86 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | 3,5-bis(4-butylphenyl)-12,14-dimethyl-4,13-dithiahexacyclo[8.8.2.02,6.07,19.011,15.016,20]icosa-1(19),2,5,7,9,11,14,16(20),17-nonaene |
| SMILES | CCCCc1ccc(-c2sc(-c3ccc(CCCC)cc3)c3c2-c2ccc4c5c(ccc-3c25)-c2c(C)sc(C)c2-4)cc1 |
| InChI | InChI=1S/C40H36S2/c1-5-7-9-25-11-15-27(16-12-25)39-37-31-21-19-29-33-23(3)41-24(4)34(33)30-20-22-32(36(31)35(29)30)38(37)40(42-39)28-17-13-26(14-18-28)10-8-6-2/h11-22H,5-10H2,1-4H3 |
| InChIKey | IWAVUQPRBUHCNP-UHFFFAOYSA-N |
| XLogP | 12.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.86 |
| LogP ≤ 5 | 12.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |