C11H11NO3 — CID 58122807
2-ethenoxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonitrile (PubChem CID 58122807) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 2-ethenoxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonitrile.
| Compound Name | 2-ethenoxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonitrile |
|---|---|
| PubChem CID | 58122807 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 2-ethenoxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonitrile |
| SMILES | C=COC1C2CC3C1OC(=O)C3C2C#N |
| InChI | InChI=1S/C11H11NO3/c1-2-14-9-5-3-6-8(7(5)4-12)11(13)15-10(6)9/h2,5-10H,1,3H2 |
| InChIKey | FQVHSGXHFUOAPK-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|