C41H48O4S2 — CID 58133514
(2R,3R,4S,5R,6R)-6-ethyl-2-[2-[2-[(4-ethylphenyl)methyl]phenyl]-1,3-dithian-2-yl]-5-methyl-3,4-bis(phenylmethoxy)oxan-2-ol (PubChem CID 58133514) has the molecular formula C41H48O4S2 and a molecular weight of 668.97 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-6-ethyl-2-[2-[2-[(4-ethylphenyl)methyl]phenyl]-1,3-dithian-2-yl]-5-methyl-3,4-bis(phenylmethoxy)oxan-2-ol.
| Compound Name | (2R,3R,4S,5R,6R)-6-ethyl-2-[2-[2-[(4-ethylphenyl)methyl]phenyl]-1,3-dithian-2-yl]-5-methyl-3,4-bis(phenylmethoxy)oxan-2-ol |
|---|---|
| PubChem CID | 58133514 |
| Molecular Formula | C41H48O4S2 |
| Molecular Weight | 668.97 g/mol |
| Exact Mass | 668.30 |
| IUPAC Name | (2R,3R,4S,5R,6R)-6-ethyl-2-[2-[2-[(4-ethylphenyl)methyl]phenyl]-1,3-dithian-2-yl]-5-methyl-3,4-bis(phenylmethoxy)oxan-2-ol |
| SMILES | CCc1ccc(Cc2ccccc2C2([C@]3(O)O[C@H](CC)[C@@H](C)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)SCCCS2)cc1 |
| InChI | InChI=1S/C41H48O4S2/c1-4-31-21-23-32(24-22-31)27-35-19-12-13-20-36(35)41(46-25-14-26-47-41)40(42)39(44-29-34-17-10-7-11-18-34)38(30(3)37(5-2)45-40)43-28-33-15-8-6-9-16-33/h6-13,15-24,30,37-39,42H,4-5,14,25-29H2,1-3H3/t30-,37-,38+,39-,40-/m1/s1 |
| InChIKey | PPBFELXZNYHUIL-XGMSLRGMSA-N |
| XLogP | 9.17 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.97 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |