C22H29N3O3 — CID 58135549
(2S)-3,3-dimethyl-2-[2-(8-methyl-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl)-2-oxoethyl]butanoic acid (PubChem CID 58135549) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is (2S)-3,3-dimethyl-2-[2-(8-methyl-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl)-2-oxoethyl]butanoic acid.
| Compound Name | (2S)-3,3-dimethyl-2-[2-(8-methyl-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl)-2-oxoethyl]butanoic acid |
|---|---|
| PubChem CID | 58135549 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | (2S)-3,3-dimethyl-2-[2-(8-methyl-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl)-2-oxoethyl]butanoic acid |
| SMILES | CN1CCCn2c(-c3ccccc3)nc(C(=O)C[C@H](C(=O)O)C(C)(C)C)c2C1 |
| InChI | InChI=1S/C22H29N3O3/c1-22(2,3)16(21(27)28)13-18(26)19-17-14-24(4)11-8-12-25(17)20(23-19)15-9-6-5-7-10-15/h5-7,9-10,16H,8,11-14H2,1-4H3,(H,27,28)/t16-/m1/s1 |
| InChIKey | JEYSEBRMWHMUOY-MRXNPFEDSA-N |
| XLogP | 3.71 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |