C27H37N3O5 — CID 58135699
tert-butyl 1-[(3S)-3-methoxycarbonyl-4,4-dimethylpentanoyl]-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-8-carboxylate (PubChem CID 58135699) has the molecular formula C27H37N3O5 and a molecular weight of 483.61 g/mol. Its IUPAC name is tert-butyl 1-[(3S)-3-methoxycarbonyl-4,4-dimethylpentanoyl]-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-8-carboxylate.
| Compound Name | tert-butyl 1-[(3S)-3-methoxycarbonyl-4,4-dimethylpentanoyl]-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-8-carboxylate |
|---|---|
| PubChem CID | 58135699 |
| Molecular Formula | C27H37N3O5 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | tert-butyl 1-[(3S)-3-methoxycarbonyl-4,4-dimethylpentanoyl]-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-8-carboxylate |
| SMILES | COC(=O)[C@@H](CC(=O)c1nc(-c2ccccc2)n2c1CN(C(=O)OC(C)(C)C)CCC2)C(C)(C)C |
| InChI | InChI=1S/C27H37N3O5/c1-26(2,3)19(24(32)34-7)16-21(31)22-20-17-29(25(33)35-27(4,5)6)14-11-15-30(20)23(28-22)18-12-9-8-10-13-18/h8-10,12-13,19H,11,14-17H2,1-7H3/t19-/m1/s1 |
| InChIKey | HREGCFFUQVGHET-LJQANCHMSA-N |
| XLogP | 5.10 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |