C24H38NP — CID 58140352
N-[dimethyl-(4,4,6,6-tetramethyl-5H-pentalen-2-ylidene)-λ5-phosphanyl]adamantan-1-amine (PubChem CID 58140352) has the molecular formula C24H38NP and a molecular weight of 371.55 g/mol. Its IUPAC name is N-[dimethyl-(4,4,6,6-tetramethyl-5H-pentalen-2-ylidene)-λ5-phosphanyl]adamantan-1-amine.
| Compound Name | N-[dimethyl-(4,4,6,6-tetramethyl-5H-pentalen-2-ylidene)-λ5-phosphanyl]adamantan-1-amine |
|---|---|
| PubChem CID | 58140352 |
| Molecular Formula | C24H38NP |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.27 |
| IUPAC Name | N-[dimethyl-(4,4,6,6-tetramethyl-5H-pentalen-2-ylidene)-λ5-phosphanyl]adamantan-1-amine |
| SMILES | CC1(C)CC(C)(C)C2=CC(=P(C)(C)NC34CC5CC(CC(C5)C3)C4)C=C21 |
| InChI | InChI=1S/C24H38NP/c1-22(2)15-23(3,4)21-11-19(10-20(21)22)26(5,6)25-24-12-16-7-17(13-24)9-18(8-16)14-24/h10-11,16-18,25H,7-9,12-15H2,1-6H3 |
| InChIKey | WOMQBQPCHISMCR-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|