C9H20O4 — CID 58201927
(2R,3R)-4-tert-butylpentane-1,2,3,5-tetrol (PubChem CID 58201927) has the molecular formula C9H20O4 and a molecular weight of 192.25 g/mol. Its IUPAC name is (2R,3R)-4-tert-butylpentane-1,2,3,5-tetrol.
| Compound Name | (2R,3R)-4-tert-butylpentane-1,2,3,5-tetrol |
|---|---|
| PubChem CID | 58201927 |
| Molecular Formula | C9H20O4 |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | (2R,3R)-4-tert-butylpentane-1,2,3,5-tetrol |
| SMILES | CC(C)(C)C(CO)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H20O4/c1-9(2,3)6(4-10)8(13)7(12)5-11/h6-8,10-13H,4-5H2,1-3H3/t6?,7-,8-/m1/s1 |
| InChIKey | LSGNFJPBCPSIDK-SPDVFEMOSA-N |
| XLogP | -0.64 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |