C15H15CsNO+ — CID 58233243
cesium 2-[(2,5-dimethylphenyl)azaniumylidenemethyl]phenolate (PubChem CID 58233243) has the molecular formula C15H15CsNO+ and a molecular weight of 358.20 g/mol. Its IUPAC name is cesium 2-[(2,5-dimethylphenyl)azaniumylidenemethyl]phenolate.
| Compound Name | cesium 2-[(2,5-dimethylphenyl)azaniumylidenemethyl]phenolate |
|---|---|
| PubChem CID | 58233243 |
| Molecular Formula | C15H15CsNO+ |
| Molecular Weight | 358.20 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | cesium 2-[(2,5-dimethylphenyl)azaniumylidenemethyl]phenolate |
| SMILES | Cc1ccc(C)c(/[NH+]=C/c2ccccc2[O-])c1.[Cs+] |
| InChI | InChI=1S/C15H15NO.Cs/c1-11-7-8-12(2)14(9-11)16-10-13-5-3-4-6-15(13)17;/h3-10,17H,1-2H3;/q;+1/b16-10+; |
| InChIKey | SFPOWFISEFCWPX-QFHYWFJHSA-N |
| XLogP | -1.79 |
| TPSA | 37.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.20 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|