C19H20BF2N3OS — CID 58291325
N,N-diethyl-3,3-difluoro-4-(6-methyl-1,3-benzothiazol-2-yl)-2-oxa-4-azonia-3-boranuidabicyclo[4.4.0]deca-1(6),4,7,9-tetraen-9-amine (PubChem CID 58291325) has the molecular formula C19H20BF2N3OS and a molecular weight of 387.26 g/mol. Its IUPAC name is N,N-diethyl-3,3-difluoro-4-(6-methyl-1,3-benzothiazol-2-yl)-2-oxa-4-azonia-3-boranuidabicyclo[4.4.0]deca-1(6),4,7,9-tetraen-9-amine.
| Compound Name | N,N-diethyl-3,3-difluoro-4-(6-methyl-1,3-benzothiazol-2-yl)-2-oxa-4-azonia-3-boranuidabicyclo[4.4.0]deca-1(6),4,7,9-tetraen-9-amine |
|---|---|
| PubChem CID | 58291325 |
| Molecular Formula | C19H20BF2N3OS |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | N,N-diethyl-3,3-difluoro-4-(6-methyl-1,3-benzothiazol-2-yl)-2-oxa-4-azonia-3-boranuidabicyclo[4.4.0]deca-1(6),4,7,9-tetraen-9-amine |
| SMILES | CCN(CC)c1ccc2c(c1)O[B-](F)(F)[N+](c1nc3ccc(C)cc3s1)=C2 |
| InChI | InChI=1S/C19H20BF2N3OS/c1-4-24(5-2)15-8-7-14-12-25(20(21,22)26-17(14)11-15)19-23-16-9-6-13(3)10-18(16)27-19/h6-12H,4-5H2,1-3H3 |
| InChIKey | XRJSJLCGLAUMBM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 28.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|