C17H23NO — CID 58303883
2,3-ditert-butyl-1,4-benzoxazepine (PubChem CID 58303883) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 2,3-ditert-butyl-1,4-benzoxazepine.
| Compound Name | 2,3-ditert-butyl-1,4-benzoxazepine |
|---|---|
| PubChem CID | 58303883 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 2,3-ditert-butyl-1,4-benzoxazepine |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)Oc2ccccc2C=N1 |
| InChI | InChI=1S/C17H23NO/c1-16(2,3)14-15(17(4,5)6)19-13-10-8-7-9-12(13)11-18-14/h7-11H,1-6H3 |
| InChIKey | RXBFWJKYTPDFIK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |