C42H49F2NO13 — CID 58309132
(4-nitrophenyl)methyl 5-[4-[4-(2-fluoroprop-2-enoyloxy)butoxy]cyclohexanecarbonyl]oxy-2-[4-[4-(2-fluoroprop-2-enoyloxy)butyl]cyclohexanecarbonyl]oxybenzoate (PubChem CID 58309132) has the molecular formula C42H49F2NO13 and a molecular weight of 813.84 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 5-[4-[4-(2-fluoroprop-2-enoyloxy)butoxy]cyclohexanecarbonyl]oxy-2-[4-[4-(2-fluoroprop-2-enoyloxy)butyl]cyclohexanecarbonyl]oxybenzoate.
| Compound Name | (4-nitrophenyl)methyl 5-[4-[4-(2-fluoroprop-2-enoyloxy)butoxy]cyclohexanecarbonyl]oxy-2-[4-[4-(2-fluoroprop-2-enoyloxy)butyl]cyclohexanecarbonyl]oxybenzoate |
|---|---|
| PubChem CID | 58309132 |
| Molecular Formula | C42H49F2NO13 |
| Molecular Weight | 813.84 g/mol |
| Exact Mass | 813.32 |
| IUPAC Name | (4-nitrophenyl)methyl 5-[4-[4-(2-fluoroprop-2-enoyloxy)butoxy]cyclohexanecarbonyl]oxy-2-[4-[4-(2-fluoroprop-2-enoyloxy)butyl]cyclohexanecarbonyl]oxybenzoate |
| SMILES | C=C(F)C(=O)OCCCCOC1CCC(C(=O)Oc2ccc(OC(=O)C3CCC(CCCCOC(=O)C(=C)F)CC3)c(C(=O)OCc3ccc([N+](=O)[O-])cc3)c2)CC1 |
| InChI | InChI=1S/C42H49F2NO13/c1-27(43)38(46)54-23-4-3-7-29-8-12-31(13-9-29)41(49)58-37-21-20-35(25-36(37)42(50)56-26-30-10-16-33(17-11-30)45(51)52)57-40(48)32-14-18-34(19-15-32)53-22-5-6-24-55-39(47)28(2)44/h10-11,16-17,20-21,25,29,31-32,34H,1-9,12-15,18-19,22-24,26H2 |
| InChIKey | OMFLGGJSLOUJEZ-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 183.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.84 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|