C27H30ClN5O2S — CID 58311612
(5Z)-5-[[1-[[2-chloro-4-(2-hydroxypropan-2-yl)phenyl]methyl]indazol-5-yl]methylidene]-2-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-1,3-thiazol-4-one (PubChem CID 58311612) has the molecular formula C27H30ClN5O2S and a molecular weight of 524.09 g/mol. Its IUPAC name is (5Z)-5-[[1-[[2-chloro-4-(2-hydroxypropan-2-yl)phenyl]methyl]indazol-5-yl]methylidene]-2-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[[1-[[2-chloro-4-(2-hydroxypropan-2-yl)phenyl]methyl]indazol-5-yl]methylidene]-2-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 58311612 |
| Molecular Formula | C27H30ClN5O2S |
| Molecular Weight | 524.09 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | (5Z)-5-[[1-[[2-chloro-4-(2-hydroxypropan-2-yl)phenyl]methyl]indazol-5-yl]methylidene]-2-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-1,3-thiazol-4-one |
| SMILES | C[C@@H]1CN(C2=NC(=O)/C(=C/c3ccc4c(cnn4Cc4ccc(C(C)(C)O)cc4Cl)c3)S2)C[C@H](C)N1 |
| InChI | InChI=1S/C27H30ClN5O2S/c1-16-13-32(14-17(2)30-16)26-31-25(34)24(36-26)10-18-5-8-23-20(9-18)12-29-33(23)15-19-6-7-21(11-22(19)28)27(3,4)35/h5-12,16-17,30,35H,13-15H2,1-4H3/b24-10-/t16-,17+ |
| InChIKey | NGQYMJDJCPYITA-MLROBQRVSA-N |
| XLogP | 4.62 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.09 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|