C29H30ClN5O3S — CID 67240470
tert-butyl N-[1-[5-[[1-[(4-chloro-2-cyclopropylphenyl)methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]azetidin-3-yl]carbamate (PubChem CID 67240470) has the molecular formula C29H30ClN5O3S and a molecular weight of 564.11 g/mol. Its IUPAC name is tert-butyl N-[1-[5-[[1-[(4-chloro-2-cyclopropylphenyl)methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]azetidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[5-[[1-[(4-chloro-2-cyclopropylphenyl)methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]azetidin-3-yl]carbamate |
|---|---|
| PubChem CID | 67240470 |
| Molecular Formula | C29H30ClN5O3S |
| Molecular Weight | 564.11 g/mol |
| Exact Mass | 563.18 |
| IUPAC Name | tert-butyl N-[1-[5-[[1-[(4-chloro-2-cyclopropylphenyl)methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]azetidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CN(C2=NC(=O)C(=Cc3ccc4c(cnn4Cc4ccc(Cl)cc4C4CC4)c3)S2)C1 |
| InChI | InChI=1S/C29H30ClN5O3S/c1-29(2,3)38-28(37)32-22-15-34(16-22)27-33-26(36)25(39-27)11-17-4-9-24-20(10-17)13-31-35(24)14-19-7-8-21(30)12-23(19)18-5-6-18/h4,7-13,18,22H,5-6,14-16H2,1-3H3,(H,32,37) |
| InChIKey | MASAAYIDIBTYBH-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 88.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.11 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|