C27H39N5O2Si — CID 58386907
2-[2-[2-(cyclohexen-1-yl)-4-(1,3-diaminopropan-2-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile (PubChem CID 58386907) has the molecular formula C27H39N5O2Si and a molecular weight of 493.73 g/mol. Its IUPAC name is 2-[2-[2-(cyclohexen-1-yl)-4-(1,3-diaminopropan-2-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile.
| Compound Name | 2-[2-[2-(cyclohexen-1-yl)-4-(1,3-diaminopropan-2-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile |
|---|---|
| PubChem CID | 58386907 |
| Molecular Formula | C27H39N5O2Si |
| Molecular Weight | 493.73 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | 2-[2-[2-(cyclohexen-1-yl)-4-(1,3-diaminopropan-2-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1cc(C#N)nc1C(=O)Cc1ccc(C(CN)CN)cc1C1=CCCCC1 |
| InChI | InChI=1S/C27H39N5O2Si/c1-35(2,3)12-11-34-19-32-18-24(17-30)31-27(32)26(33)14-22-10-9-21(23(15-28)16-29)13-25(22)20-7-5-4-6-8-20/h7,9-10,13,18,23H,4-6,8,11-12,14-16,19,28-29H2,1-3H3 |
| InChIKey | QRCRZNHHZBQUGD-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 119.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.73 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|