C27H37N3O4Si — CID 58386915
2-[2-[2-(cyclohexen-1-yl)-4-(1,3-dihydroxypropan-2-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile (PubChem CID 58386915) has the molecular formula C27H37N3O4Si and a molecular weight of 495.70 g/mol. Its IUPAC name is 2-[2-[2-(cyclohexen-1-yl)-4-(1,3-dihydroxypropan-2-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile.
| Compound Name | 2-[2-[2-(cyclohexen-1-yl)-4-(1,3-dihydroxypropan-2-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile |
|---|---|
| PubChem CID | 58386915 |
| Molecular Formula | C27H37N3O4Si |
| Molecular Weight | 495.70 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | 2-[2-[2-(cyclohexen-1-yl)-4-(1,3-dihydroxypropan-2-yl)phenyl]acetyl]-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1cc(C#N)nc1C(=O)Cc1ccc(C(CO)CO)cc1C1=CCCCC1 |
| InChI | InChI=1S/C27H37N3O4Si/c1-35(2,3)12-11-34-19-30-16-24(15-28)29-27(30)26(33)14-22-10-9-21(23(17-31)18-32)13-25(22)20-7-5-4-6-8-20/h7,9-10,13,16,23,31-32H,4-6,8,11-12,14,17-19H2,1-3H3 |
| InChIKey | RAMVOHYAGARZMV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 108.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.70 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|