C13H11NO — CID 58409727
(8E)-8-(isocyanomethylidene)-1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran (PubChem CID 58409727) has the molecular formula C13H11NO and a molecular weight of 197.24 g/mol. Its IUPAC name is (8E)-8-(isocyanomethylidene)-1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran.
| Compound Name | (8E)-8-(isocyanomethylidene)-1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran |
|---|---|
| PubChem CID | 58409727 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | (8E)-8-(isocyanomethylidene)-1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran |
| SMILES | [C-]#[N+]/C=C1\CCc2ccc3c(c21)CCO3 |
| InChI | InChI=1S/C13H11NO/c1-14-8-10-3-2-9-4-5-12-11(13(9)10)6-7-15-12/h4-5,8H,2-3,6-7H2/b10-8+ |
| InChIKey | KAZUTOJFYPFXAV-CSKARUKUSA-N |
| XLogP | 2.83 |
| TPSA | 13.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|