C25H25NO2 — CID 58423993
6'-(3-isocyanophenyl)spiro[2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene-8,2'-3H-chromene]-4'-one (PubChem CID 58423993) has the molecular formula C25H25NO2 and a molecular weight of 371.48 g/mol. Its IUPAC name is 6'-(3-isocyanophenyl)spiro[2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene-8,2'-3H-chromene]-4'-one.
| Compound Name | 6'-(3-isocyanophenyl)spiro[2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene-8,2'-3H-chromene]-4'-one |
|---|---|
| PubChem CID | 58423993 |
| Molecular Formula | C25H25NO2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 6'-(3-isocyanophenyl)spiro[2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene-8,2'-3H-chromene]-4'-one |
| SMILES | [C-]#[N+]c1cccc(-c2ccc3c(c2)C(=O)CC2(CCCC4CCCCC42)O3)c1 |
| InChI | InChI=1S/C25H25NO2/c1-26-20-9-4-7-18(14-20)19-11-12-24-21(15-19)23(27)16-25(28-24)13-5-8-17-6-2-3-10-22(17)25/h4,7,9,11-12,14-15,17,22H,2-3,5-6,8,10,13,16H2 |
| InChIKey | TYYLUAQHSZWHRJ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 30.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|