C9H10N2OS — CID 58429259
2-methylidene-2-oxo-1H-2λ6,3-benzothiazin-4-amine (PubChem CID 58429259) has the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. Its IUPAC name is 2-methylidene-2-oxo-1H-2λ6,3-benzothiazin-4-amine.
| Compound Name | 2-methylidene-2-oxo-1H-2λ6,3-benzothiazin-4-amine |
|---|---|
| PubChem CID | 58429259 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 2-methylidene-2-oxo-1H-2λ6,3-benzothiazin-4-amine |
| SMILES | C=S1(=O)Cc2ccccc2C(N)=N1 |
| InChI | InChI=1S/C9H10N2OS/c1-13(12)6-7-4-2-3-5-8(7)9(10)11-13/h2-5H,1,6H2,(H2,10,11,12) |
| InChIKey | AMZVELGZESUFCC-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|