C30H35ClN2O6 — CID 58492313
3-[[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl-methylamino]-N-methylbenzamide (PubChem CID 58492313) has the molecular formula C30H35ClN2O6 and a molecular weight of 555.07 g/mol. Its IUPAC name is 3-[[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl-methylamino]-N-methylbenzamide.
| Compound Name | 3-[[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl-methylamino]-N-methylbenzamide |
|---|---|
| PubChem CID | 58492313 |
| Molecular Formula | C30H35ClN2O6 |
| Molecular Weight | 555.07 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | 3-[[(2R,3S,4R,5R,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-3,4,5-trihydroxyoxan-2-yl]methyl-methylamino]-N-methylbenzamide |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3O[C@H](CN(C)c4cccc(C(=O)NC)c4)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C30H35ClN2O6/c1-4-38-23-11-8-18(9-12-23)14-21-15-19(10-13-24(21)31)29-28(36)27(35)26(34)25(39-29)17-33(3)22-7-5-6-20(16-22)30(37)32-2/h5-13,15-16,25-29,34-36H,4,14,17H2,1-3H3,(H,32,37)/t25-,26-,27+,28-,29+/m1/s1 |
| InChIKey | PUUCTMNZNUYHAY-RQKPWJHBSA-N |
| XLogP | 3.35 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.07 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |