C11H6FIrN2- — CID 58517581
6-fluoro-10H-imidazo[2,1-a]isoquinolin-10-ide;iridium (PubChem CID 58517581) has the molecular formula C11H6FIrN2- and a molecular weight of 377.40 g/mol. Its IUPAC name is 6-fluoro-10H-imidazo[2,1-a]isoquinolin-10-ide;iridium.
| Compound Name | 6-fluoro-10H-imidazo[2,1-a]isoquinolin-10-ide;iridium |
|---|---|
| PubChem CID | 58517581 |
| Molecular Formula | C11H6FIrN2- |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 6-fluoro-10H-imidazo[2,1-a]isoquinolin-10-ide;iridium |
| SMILES | Fc1cn2ccnc2c2[c-]cccc12.[Ir] |
| InChI | InChI=1S/C11H6FN2.Ir/c12-10-7-14-6-5-13-11(14)9-4-2-1-3-8(9)10;/h1-3,5-7H;/q-1; |
| InChIKey | WNCCOVDVNOOVKK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|