C19H24N6O3 — CID 58551985
methyl 2-[3-[[2-(6-amino-8-methoxy-2-methylpurin-9-yl)ethylamino]methyl]phenyl]acetate (PubChem CID 58551985) has the molecular formula C19H24N6O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is methyl 2-[3-[[2-(6-amino-8-methoxy-2-methylpurin-9-yl)ethylamino]methyl]phenyl]acetate.
| Compound Name | methyl 2-[3-[[2-(6-amino-8-methoxy-2-methylpurin-9-yl)ethylamino]methyl]phenyl]acetate |
|---|---|
| PubChem CID | 58551985 |
| Molecular Formula | C19H24N6O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | methyl 2-[3-[[2-(6-amino-8-methoxy-2-methylpurin-9-yl)ethylamino]methyl]phenyl]acetate |
| SMILES | COC(=O)Cc1cccc(CNCCn2c(OC)nc3c(N)nc(C)nc32)c1 |
| InChI | InChI=1S/C19H24N6O3/c1-12-22-17(20)16-18(23-12)25(19(24-16)28-3)8-7-21-11-14-6-4-5-13(9-14)10-15(26)27-2/h4-6,9,21H,7-8,10-11H2,1-3H3,(H2,20,22,23) |
| InChIKey | DVDKSUBVUCDBKS-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|