C17H16N6O3 — CID 58552054
2-[2-(6-amino-8-methoxy-2-methylpurin-9-yl)ethyl]isoindole-1,3-dione (PubChem CID 58552054) has the molecular formula C17H16N6O3 and a molecular weight of 352.35 g/mol. Its IUPAC name is 2-[2-(6-amino-8-methoxy-2-methylpurin-9-yl)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(6-amino-8-methoxy-2-methylpurin-9-yl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58552054 |
| Molecular Formula | C17H16N6O3 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 2-[2-(6-amino-8-methoxy-2-methylpurin-9-yl)ethyl]isoindole-1,3-dione |
| SMILES | COc1nc2c(N)nc(C)nc2n1CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H16N6O3/c1-9-19-13(18)12-14(20-9)22(17(21-12)26-2)7-8-23-15(24)10-5-3-4-6-11(10)16(23)25/h3-6H,7-8H2,1-2H3,(H2,18,19,20) |
| InChIKey | SNGVZYAOKSIKNS-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 116.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|