C15H15N5O4 — CID 58552079
2-[2-(6-amino-2-methyl-8-oxo-7H-purin-9-yl)ethoxy]benzoic acid (PubChem CID 58552079) has the molecular formula C15H15N5O4 and a molecular weight of 329.32 g/mol. Its IUPAC name is 2-[2-(6-amino-2-methyl-8-oxo-7H-purin-9-yl)ethoxy]benzoic acid.
| Compound Name | 2-[2-(6-amino-2-methyl-8-oxo-7H-purin-9-yl)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 58552079 |
| Molecular Formula | C15H15N5O4 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 2-[2-(6-amino-2-methyl-8-oxo-7H-purin-9-yl)ethoxy]benzoic acid |
| SMILES | Cc1nc(N)c2[nH]c(=O)n(CCOc3ccccc3C(=O)O)c2n1 |
| InChI | InChI=1S/C15H15N5O4/c1-8-17-12(16)11-13(18-8)20(15(23)19-11)6-7-24-10-5-3-2-4-9(10)14(21)22/h2-5H,6-7H2,1H3,(H,19,23)(H,21,22)(H2,16,17,18) |
| InChIKey | VDDYTYRFKJRNIZ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |