C32H30N2O4S — CID 58616267
1-amino-4-[3-(5-phenylhexan-3-ylsulfonyl)anilino]anthracene-9,10-dione (PubChem CID 58616267) has the molecular formula C32H30N2O4S and a molecular weight of 538.67 g/mol. Its IUPAC name is 1-amino-4-[3-(5-phenylhexan-3-ylsulfonyl)anilino]anthracene-9,10-dione.
| Compound Name | 1-amino-4-[3-(5-phenylhexan-3-ylsulfonyl)anilino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 58616267 |
| Molecular Formula | C32H30N2O4S |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | 1-amino-4-[3-(5-phenylhexan-3-ylsulfonyl)anilino]anthracene-9,10-dione |
| SMILES | CCC(CC(C)c1ccccc1)S(=O)(=O)c1cccc(Nc2ccc(N)c3c2C(=O)c2ccccc2C3=O)c1 |
| InChI | InChI=1S/C32H30N2O4S/c1-3-23(18-20(2)21-10-5-4-6-11-21)39(37,38)24-13-9-12-22(19-24)34-28-17-16-27(33)29-30(28)32(36)26-15-8-7-14-25(26)31(29)35/h4-17,19-20,23,34H,3,18,33H2,1-2H3 |
| InChIKey | HAEMCDHEOSORSR-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|