C27H33F5N4O5S — CID 58623181
1-ethyl-N-(oxan-2-yloxy)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 58623181) has the molecular formula C27H33F5N4O5S and a molecular weight of 620.64 g/mol. Its IUPAC name is 1-ethyl-N-(oxan-2-yloxy)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-ethyl-N-(oxan-2-yloxy)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 58623181 |
| Molecular Formula | C27H33F5N4O5S |
| Molecular Weight | 620.64 g/mol |
| Exact Mass | 620.21 |
| IUPAC Name | 1-ethyl-N-(oxan-2-yloxy)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | CCN1CCC(C(=O)NOC2CCCCO2)(S(=O)(=O)c2ccc(-c3cnc(CCC(F)(F)C(F)(F)F)cn3)cc2)CC1 |
| InChI | InChI=1S/C27H33F5N4O5S/c1-2-36-14-12-25(13-15-36,24(37)35-41-23-5-3-4-16-40-23)42(38,39)21-8-6-19(7-9-21)22-18-33-20(17-34-22)10-11-26(28,29)27(30,31)32/h6-9,17-18,23H,2-5,10-16H2,1H3,(H,35,37) |
| InChIKey | JMCWMUCQICAYFR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.64 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|