C29H36F5N3O6S — CID 58623226
1-(2-methoxyethyl)-N-(oxan-2-yloxy)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 58623226) has the molecular formula C29H36F5N3O6S and a molecular weight of 649.68 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-N-(oxan-2-yloxy)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-(2-methoxyethyl)-N-(oxan-2-yloxy)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 58623226 |
| Molecular Formula | C29H36F5N3O6S |
| Molecular Weight | 649.68 g/mol |
| Exact Mass | 649.22 |
| IUPAC Name | 1-(2-methoxyethyl)-N-(oxan-2-yloxy)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | COCCN1CCC(C(=O)NOC2CCCCO2)(S(=O)(=O)c2ccc(-c3ccc(CCC(F)(F)C(F)(F)F)cn3)cc2)CC1 |
| InChI | InChI=1S/C29H36F5N3O6S/c1-41-19-17-37-15-13-27(14-16-37,26(38)36-43-25-4-2-3-18-42-25)44(39,40)23-8-6-22(7-9-23)24-10-5-21(20-35-24)11-12-28(30,31)29(32,33)34/h5-10,20,25H,2-4,11-19H2,1H3,(H,36,38) |
| InChIKey | UFGMRQCIGDYGFO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.68 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|