C26H29F5N2O6S — CID 58623247
N-(oxan-2-yloxy)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 58623247) has the molecular formula C26H29F5N2O6S and a molecular weight of 592.58 g/mol. Its IUPAC name is N-(oxan-2-yloxy)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-(oxan-2-yloxy)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 58623247 |
| Molecular Formula | C26H29F5N2O6S |
| Molecular Weight | 592.58 g/mol |
| Exact Mass | 592.17 |
| IUPAC Name | N-(oxan-2-yloxy)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(NOC1CCCCO1)C1(S(=O)(=O)c2ccc(-c3ccc(CCC(F)(F)C(F)(F)F)cn3)cc2)CCOCC1 |
| InChI | InChI=1S/C26H29F5N2O6S/c27-25(28,26(29,30)31)11-10-18-4-9-21(32-17-18)19-5-7-20(8-6-19)40(35,36)24(12-15-37-16-13-24)23(34)33-39-22-3-1-2-14-38-22/h4-9,17,22H,1-3,10-16H2,(H,33,34) |
| InChIKey | GOLLNGZRQSKEQH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|