C26H32F3NO6S — CID 58623260
4-methoxy-N-(oxan-2-yloxy)-2-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylbutanamide (PubChem CID 58623260) has the molecular formula C26H32F3NO6S and a molecular weight of 543.60 g/mol. Its IUPAC name is 4-methoxy-N-(oxan-2-yloxy)-2-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylbutanamide.
| Compound Name | 4-methoxy-N-(oxan-2-yloxy)-2-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylbutanamide |
|---|---|
| PubChem CID | 58623260 |
| Molecular Formula | C26H32F3NO6S |
| Molecular Weight | 543.60 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | 4-methoxy-N-(oxan-2-yloxy)-2-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylbutanamide |
| SMILES | COCCC(C(=O)NOC1CCCCO1)S(=O)(=O)c1ccc(-c2ccc(CCCC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C26H32F3NO6S/c1-34-18-15-23(25(31)30-36-24-6-2-3-17-35-24)37(32,33)22-13-11-21(12-14-22)20-9-7-19(8-10-20)5-4-16-26(27,28)29/h7-14,23-24H,2-6,15-18H2,1H3,(H,30,31) |
| InChIKey | WTLWPPGJGQJDPW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.60 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|