C24H33O2Y- — CID 58650720
2'-(3,5-dimethylbenzene-4-id-1-yl)spiro[1,3-dioxolane-2,7'-2,3,4,4a,4b,5,6,8,8a,9,10,10a-dodecahydro-1H-phenanthrene];yttrium (PubChem CID 58650720) has the molecular formula C24H33O2Y- and a molecular weight of 442.43 g/mol. Its IUPAC name is 2'-(3,5-dimethylbenzene-4-id-1-yl)spiro[1,3-dioxolane-2,7'-2,3,4,4a,4b,5,6,8,8a,9,10,10a-dodecahydro-1H-phenanthrene];yttrium.
| Compound Name | 2'-(3,5-dimethylbenzene-4-id-1-yl)spiro[1,3-dioxolane-2,7'-2,3,4,4a,4b,5,6,8,8a,9,10,10a-dodecahydro-1H-phenanthrene];yttrium |
|---|---|
| PubChem CID | 58650720 |
| Molecular Formula | C24H33O2Y- |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 2'-(3,5-dimethylbenzene-4-id-1-yl)spiro[1,3-dioxolane-2,7'-2,3,4,4a,4b,5,6,8,8a,9,10,10a-dodecahydro-1H-phenanthrene];yttrium |
| SMILES | Cc1[c-]c(C)cc(C2CCC3C(CCC4CC5(CCC43)OCCO5)C2)c1.[Y] |
| InChI | InChI=1S/C24H33O2.Y/c1-16-11-17(2)13-21(12-16)18-5-6-22-19(14-18)3-4-20-15-24(8-7-23(20)22)25-9-10-26-24;/h12-13,18-20,22-23H,3-10,14-15H2,1-2H3;/q-1; |
| InChIKey | FZFZTMFASVXVTP-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|